C11H3ClF5N3O — CID 107595794
N-(5-chloropyrazin-2-yl)-2,3,4,5,6-pentafluorobenzamide (PubChem CID 107595794) has the molecular formula C11H3ClF5N3O and a molecular weight of 323.61 g/mol. Its IUPAC name is N-(5-chloropyrazin-2-yl)-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-(5-chloropyrazin-2-yl)-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 107595794 |
| Molecular Formula | C11H3ClF5N3O |
| Molecular Weight | 323.61 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | N-(5-chloropyrazin-2-yl)-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(Nc1cnc(Cl)cn1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H3ClF5N3O/c12-3-1-19-4(2-18-3)20-11(21)5-6(13)8(15)10(17)9(16)7(5)14/h1-2H,(H,19,20,21) |
| InChIKey | CTJGDYFAHZWGGN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.61 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|