C18H20F3N3O — CID 109195665
5-(3-methylbutylamino)-N-[4-(trifluoromethyl)phenyl]pyridine-2-carboxamide (PubChem CID 109195665) has the molecular formula C18H20F3N3O and a molecular weight of 351.37 g/mol. Its IUPAC name is 5-(3-methylbutylamino)-N-[4-(trifluoromethyl)phenyl]pyridine-2-carboxamide.
| Compound Name | 5-(3-methylbutylamino)-N-[4-(trifluoromethyl)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109195665 |
| Molecular Formula | C18H20F3N3O |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 5-(3-methylbutylamino)-N-[4-(trifluoromethyl)phenyl]pyridine-2-carboxamide |
| SMILES | CC(C)CCNc1ccc(C(=O)Nc2ccc(C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C18H20F3N3O/c1-12(2)9-10-22-15-7-8-16(23-11-15)17(25)24-14-5-3-13(4-6-14)18(19,20)21/h3-8,11-12,22H,9-10H2,1-2H3,(H,24,25) |
| InChIKey | ARUMLEMZPUHCTL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |