C19H25N3O3 — CID 109195662
N-(3,4-dimethoxyphenyl)-5-(3-methylbutylamino)pyridine-2-carboxamide (PubChem CID 109195662) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-5-(3-methylbutylamino)pyridine-2-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-5-(3-methylbutylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109195662 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-5-(3-methylbutylamino)pyridine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc(NCCC(C)C)cn2)cc1OC |
| InChI | InChI=1S/C19H25N3O3/c1-13(2)9-10-20-15-5-7-16(21-12-15)19(23)22-14-6-8-17(24-3)18(11-14)25-4/h5-8,11-13,20H,9-10H2,1-4H3,(H,22,23) |
| InChIKey | NHYRYMSGOWZZCV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |