C18H24N4O3 — CID 109125202
N-(3,4-dimethoxyphenyl)-6-(3-methylbutylamino)pyridazine-3-carboxamide (PubChem CID 109125202) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-6-(3-methylbutylamino)pyridazine-3-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-6-(3-methylbutylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109125202 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-6-(3-methylbutylamino)pyridazine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc(NCCC(C)C)nn2)cc1OC |
| InChI | InChI=1S/C18H24N4O3/c1-12(2)9-10-19-17-8-6-14(21-22-17)18(23)20-13-5-7-15(24-3)16(11-13)25-4/h5-8,11-12H,9-10H2,1-4H3,(H,19,22)(H,20,23) |
| InChIKey | GOHLZBCFYHXYRL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |