C12H11F3N2O — CID 113245115
N-pent-4-ynyl-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 113245115) has the molecular formula C12H11F3N2O and a molecular weight of 256.23 g/mol. Its IUPAC name is N-pent-4-ynyl-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-pent-4-ynyl-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 113245115 |
| Molecular Formula | C12H11F3N2O |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | N-pent-4-ynyl-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | C#CCCCNC(=O)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C12H11F3N2O/c1-2-3-4-7-16-11(18)10-6-5-9(8-17-10)12(13,14)15/h1,5-6,8H,3-4,7H2,(H,16,18) |
| InChIKey | ZYYAVUHQBMZMKX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|