C12H14BrF3N2O — CID 106130786
N-(4-bromopentyl)-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 106130786) has the molecular formula C12H14BrF3N2O and a molecular weight of 339.16 g/mol. Its IUPAC name is N-(4-bromopentyl)-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-(4-bromopentyl)-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106130786 |
| Molecular Formula | C12H14BrF3N2O |
| Molecular Weight | 339.16 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | N-(4-bromopentyl)-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | CC(Br)CCCNC(=O)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C12H14BrF3N2O/c1-8(13)3-2-6-17-11(19)10-5-4-9(7-18-10)12(14,15)16/h4-5,7-8H,2-3,6H2,1H3,(H,17,19) |
| InChIKey | BAJGXIHETQLIGG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.16 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|