C13H16BrF3N2O — CID 107157596
N-(2-bromo-4-methylpentyl)-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 107157596) has the molecular formula C13H16BrF3N2O and a molecular weight of 353.18 g/mol. Its IUPAC name is N-(2-bromo-4-methylpentyl)-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-(2-bromo-4-methylpentyl)-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107157596 |
| Molecular Formula | C13H16BrF3N2O |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | N-(2-bromo-4-methylpentyl)-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | CC(C)CC(Br)CNC(=O)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C13H16BrF3N2O/c1-8(2)5-10(14)7-19-12(20)11-4-3-9(6-18-11)13(15,16)17/h3-4,6,8,10H,5,7H2,1-2H3,(H,19,20) |
| InChIKey | UTTAXSJLIRNZNW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|