C17H26N2O3 — CID 122108015
2-[[(5-tert-butylpyridine-2-carbonyl)amino]methyl]-4-methylpentanoic acid (PubChem CID 122108015) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-[[(5-tert-butylpyridine-2-carbonyl)amino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[(5-tert-butylpyridine-2-carbonyl)amino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122108015 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 2-[[(5-tert-butylpyridine-2-carbonyl)amino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNC(=O)c1ccc(C(C)(C)C)cn1)C(=O)O |
| InChI | InChI=1S/C17H26N2O3/c1-11(2)8-12(16(21)22)9-19-15(20)14-7-6-13(10-18-14)17(3,4)5/h6-7,10-12H,8-9H2,1-5H3,(H,19,20)(H,21,22) |
| InChIKey | FNPHVNYXTMPIPO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |