C11H9F3N2O — CID 114389784
N-but-3-yn-2-yl-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 114389784) has the molecular formula C11H9F3N2O and a molecular weight of 242.20 g/mol. Its IUPAC name is N-but-3-yn-2-yl-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-but-3-yn-2-yl-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114389784 |
| Molecular Formula | C11H9F3N2O |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | N-but-3-yn-2-yl-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | C#CC(C)NC(=O)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C11H9F3N2O/c1-3-7(2)16-10(17)9-5-4-8(6-15-9)11(12,13)14/h1,4-7H,2H3,(H,16,17) |
| InChIKey | VNMCXPDWIIZMIY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|