C16H13Cl2F3N2O3 — CID 22006727
N-[3-(2,6-dichloro-4-hydroxyphenoxy)propyl]-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 22006727) has the molecular formula C16H13Cl2F3N2O3 and a molecular weight of 409.19 g/mol. Its IUPAC name is N-[3-(2,6-dichloro-4-hydroxyphenoxy)propyl]-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[3-(2,6-dichloro-4-hydroxyphenoxy)propyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 22006727 |
| Molecular Formula | C16H13Cl2F3N2O3 |
| Molecular Weight | 409.19 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | N-[3-(2,6-dichloro-4-hydroxyphenoxy)propyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | O=C(NCCCOc1c(Cl)cc(O)cc1Cl)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C16H13Cl2F3N2O3/c17-11-6-10(24)7-12(18)14(11)26-5-1-4-22-15(25)13-3-2-9(8-23-13)16(19,20)21/h2-3,6-8,24H,1,4-5H2,(H,22,25) |
| InChIKey | OIXFLANIHYHGGN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.19 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|