C15H15Cl2N3O3 — CID 22006886
N-[4-(2,6-dichloro-4-hydroxyphenoxy)butyl]pyrazine-2-carboxamide (PubChem CID 22006886) has the molecular formula C15H15Cl2N3O3 and a molecular weight of 356.21 g/mol. Its IUPAC name is N-[4-(2,6-dichloro-4-hydroxyphenoxy)butyl]pyrazine-2-carboxamide.
| Compound Name | N-[4-(2,6-dichloro-4-hydroxyphenoxy)butyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 22006886 |
| Molecular Formula | C15H15Cl2N3O3 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | N-[4-(2,6-dichloro-4-hydroxyphenoxy)butyl]pyrazine-2-carboxamide |
| SMILES | O=C(NCCCCOc1c(Cl)cc(O)cc1Cl)c1cnccn1 |
| InChI | InChI=1S/C15H15Cl2N3O3/c16-11-7-10(21)8-12(17)14(11)23-6-2-1-3-20-15(22)13-9-18-4-5-19-13/h4-5,7-9,21H,1-3,6H2,(H,20,22) |
| InChIKey | CYRSQGHOMFRKJU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|