C10H13ClN4O3 — CID 108574671
2-chloroethyl N-[2-(pyrazine-2-carbonylamino)ethyl]carbamate (PubChem CID 108574671) has the molecular formula C10H13ClN4O3 and a molecular weight of 272.69 g/mol. Its IUPAC name is 2-chloroethyl N-[2-(pyrazine-2-carbonylamino)ethyl]carbamate.
| Compound Name | 2-chloroethyl N-[2-(pyrazine-2-carbonylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 108574671 |
| Molecular Formula | C10H13ClN4O3 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-chloroethyl N-[2-(pyrazine-2-carbonylamino)ethyl]carbamate |
| SMILES | O=C(NCCNC(=O)c1cnccn1)OCCCl |
| InChI | InChI=1S/C10H13ClN4O3/c11-1-6-18-10(17)15-5-4-14-9(16)8-7-12-2-3-13-8/h2-3,7H,1,4-6H2,(H,14,16)(H,15,17) |
| InChIKey | ZIEBKXXUMHSVKQ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|