C14H12ClFN4O2 — CID 108542988
N-[2-[(2-chloro-6-fluorobenzoyl)amino]ethyl]pyrazine-2-carboxamide (PubChem CID 108542988) has the molecular formula C14H12ClFN4O2 and a molecular weight of 322.73 g/mol. Its IUPAC name is N-[2-[(2-chloro-6-fluorobenzoyl)amino]ethyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-[(2-chloro-6-fluorobenzoyl)amino]ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 108542988 |
| Molecular Formula | C14H12ClFN4O2 |
| Molecular Weight | 322.73 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | N-[2-[(2-chloro-6-fluorobenzoyl)amino]ethyl]pyrazine-2-carboxamide |
| SMILES | O=C(NCCNC(=O)c1c(F)cccc1Cl)c1cnccn1 |
| InChI | InChI=1S/C14H12ClFN4O2/c15-9-2-1-3-10(16)12(9)14(22)20-7-6-19-13(21)11-8-17-4-5-18-11/h1-5,8H,6-7H2,(H,19,21)(H,20,22) |
| InChIKey | ZNJTVHSQLYTKJD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.73 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|