C13H13ClN4O3S — CID 108574675
N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]pyrazine-2-carboxamide (PubChem CID 108574675) has the molecular formula C13H13ClN4O3S and a molecular weight of 340.79 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 108574675 |
| Molecular Formula | C13H13ClN4O3S |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]pyrazine-2-carboxamide |
| SMILES | O=C(NCCNS(=O)(=O)c1ccc(Cl)cc1)c1cnccn1 |
| InChI | InChI=1S/C13H13ClN4O3S/c14-10-1-3-11(4-2-10)22(20,21)18-8-7-17-13(19)12-9-15-5-6-16-12/h1-6,9,18H,7-8H2,(H,17,19) |
| InChIKey | QQBSLMQLWYLCOV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|