C9H12N4O3 — CID 108574667
methyl N-[2-(pyrazine-2-carbonylamino)ethyl]carbamate (PubChem CID 108574667) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is methyl N-[2-(pyrazine-2-carbonylamino)ethyl]carbamate.
| Compound Name | methyl N-[2-(pyrazine-2-carbonylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 108574667 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | methyl N-[2-(pyrazine-2-carbonylamino)ethyl]carbamate |
| SMILES | COC(=O)NCCNC(=O)c1cnccn1 |
| InChI | InChI=1S/C9H12N4O3/c1-16-9(15)13-5-4-12-8(14)7-6-10-2-3-11-7/h2-3,6H,4-5H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | SEAUDTGCPXWELM-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|