C13H14N4OS — CID 15231502
N-(3-pyridin-4-ylsulfanylpropyl)pyrazine-2-carboxamide (PubChem CID 15231502) has the molecular formula C13H14N4OS and a molecular weight of 274.35 g/mol. Its IUPAC name is N-(3-pyridin-4-ylsulfanylpropyl)pyrazine-2-carboxamide.
| Compound Name | N-(3-pyridin-4-ylsulfanylpropyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 15231502 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | N-(3-pyridin-4-ylsulfanylpropyl)pyrazine-2-carboxamide |
| SMILES | O=C(NCCCSc1ccncc1)c1cnccn1 |
| InChI | InChI=1S/C13H14N4OS/c18-13(12-10-15-7-8-16-12)17-4-1-9-19-11-2-5-14-6-3-11/h2-3,5-8,10H,1,4,9H2,(H,17,18) |
| InChIKey | DFYPXWRGYDSIBQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|