C17H14Cl2F3NO3 — CID 23218369
N-[3-(2,6-dichloro-4-hydroxyphenoxy)propyl]-4-(trifluoromethyl)benzamide (PubChem CID 23218369) has the molecular formula C17H14Cl2F3NO3 and a molecular weight of 408.20 g/mol. Its IUPAC name is N-[3-(2,6-dichloro-4-hydroxyphenoxy)propyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[3-(2,6-dichloro-4-hydroxyphenoxy)propyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 23218369 |
| Molecular Formula | C17H14Cl2F3NO3 |
| Molecular Weight | 408.20 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | N-[3-(2,6-dichloro-4-hydroxyphenoxy)propyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCCOc1c(Cl)cc(O)cc1Cl)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14Cl2F3NO3/c18-13-8-12(24)9-14(19)15(13)26-7-1-6-23-16(25)10-2-4-11(5-3-10)17(20,21)22/h2-5,8-9,24H,1,6-7H2,(H,23,25) |
| InChIKey | IMTZHCMFJSOOJQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.20 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|