C18H18Cl2F3NO3 — CID 18504619
3,5-dichloro-4-[6-[[5-(trifluoromethyl)-2-pyridinyl]oxy]hexoxy]phenol (PubChem CID 18504619) has the molecular formula C18H18Cl2F3NO3 and a molecular weight of 424.25 g/mol. Its IUPAC name is 3,5-dichloro-4-[6-[[5-(trifluoromethyl)-2-pyridinyl]oxy]hexoxy]phenol.
| Compound Name | 3,5-dichloro-4-[6-[[5-(trifluoromethyl)-2-pyridinyl]oxy]hexoxy]phenol |
|---|---|
| PubChem CID | 18504619 |
| Molecular Formula | C18H18Cl2F3NO3 |
| Molecular Weight | 424.25 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 3,5-dichloro-4-[6-[[5-(trifluoromethyl)-2-pyridinyl]oxy]hexoxy]phenol |
| SMILES | Oc1cc(Cl)c(OCCCCCCOc2ccc(C(F)(F)F)cn2)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2F3NO3/c19-14-9-13(25)10-15(20)17(14)27-8-4-2-1-3-7-26-16-6-5-12(11-24-16)18(21,22)23/h5-6,9-11,25H,1-4,7-8H2 |
| InChIKey | IFNNNPIZLKQUBX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.25 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|