C19H17Cl2F4NO3 — CID 54038325
2-[3-[2-chloro-4-(3-chloro-3-fluoroprop-2-enoxy)-6-methylphenoxy]propoxy]-5-(trifluoromethyl)pyridine (PubChem CID 54038325) has the molecular formula C19H17Cl2F4NO3 and a molecular weight of 454.25 g/mol. Its IUPAC name is 2-[3-[2-chloro-4-(3-chloro-3-fluoroprop-2-enoxy)-6-methylphenoxy]propoxy]-5-(trifluoromethyl)pyridine.
| Compound Name | 2-[3-[2-chloro-4-(3-chloro-3-fluoroprop-2-enoxy)-6-methylphenoxy]propoxy]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 54038325 |
| Molecular Formula | C19H17Cl2F4NO3 |
| Molecular Weight | 454.25 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 2-[3-[2-chloro-4-(3-chloro-3-fluoroprop-2-enoxy)-6-methylphenoxy]propoxy]-5-(trifluoromethyl)pyridine |
| SMILES | Cc1cc(OCC=C(F)Cl)cc(Cl)c1OCCCOc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H17Cl2F4NO3/c1-12-9-14(27-8-5-16(21)22)10-15(20)18(12)29-7-2-6-28-17-4-3-13(11-26-17)19(23,24)25/h3-5,9-11H,2,6-8H2,1H3 |
| InChIKey | LKNTYZMBEYHPOQ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.25 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|