C20H20BrCl3O3 — CID 54296946
2-[4-(4-bromophenoxy)butoxy]-1-chloro-5-(3,3-dichloroprop-2-enoxy)-3-methylbenzene (PubChem CID 54296946) has the molecular formula C20H20BrCl3O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is 2-[4-(4-bromophenoxy)butoxy]-1-chloro-5-(3,3-dichloroprop-2-enoxy)-3-methylbenzene.
| Compound Name | 2-[4-(4-bromophenoxy)butoxy]-1-chloro-5-(3,3-dichloroprop-2-enoxy)-3-methylbenzene |
|---|---|
| PubChem CID | 54296946 |
| Molecular Formula | C20H20BrCl3O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 491.97 |
| IUPAC Name | 2-[4-(4-bromophenoxy)butoxy]-1-chloro-5-(3,3-dichloroprop-2-enoxy)-3-methylbenzene |
| SMILES | Cc1cc(OCC=C(Cl)Cl)cc(Cl)c1OCCCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C20H20BrCl3O3/c1-14-12-17(26-11-8-19(23)24)13-18(22)20(14)27-10-3-2-9-25-16-6-4-15(21)5-7-16/h4-8,12-13H,2-3,9-11H2,1H3 |
| InChIKey | SBLCZDXZEKBSLY-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|