C19H17Cl4NO4 — CID 57086720
1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-2-[3-[4-(nitrosomethyl)phenoxy]propoxy]benzene (PubChem CID 57086720) has the molecular formula C19H17Cl4NO4 and a molecular weight of 465.16 g/mol. Its IUPAC name is 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-2-[3-[4-(nitrosomethyl)phenoxy]propoxy]benzene.
| Compound Name | 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-2-[3-[4-(nitrosomethyl)phenoxy]propoxy]benzene |
|---|---|
| PubChem CID | 57086720 |
| Molecular Formula | C19H17Cl4NO4 |
| Molecular Weight | 465.16 g/mol |
| Exact Mass | 462.99 |
| IUPAC Name | 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-2-[3-[4-(nitrosomethyl)phenoxy]propoxy]benzene |
| SMILES | O=NCc1ccc(OCCCOc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H17Cl4NO4/c20-16-10-15(27-9-6-18(22)23)11-17(21)19(16)28-8-1-7-26-14-4-2-13(3-5-14)12-24-25/h2-6,10-11H,1,7-9,12H2 |
| InChIKey | YVIVVAJMPBCXMP-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.16 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|