C22H20Cl4O4 — CID 87864023
(E)-4-[4-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]but-3-en-2-one (PubChem CID 87864023) has the molecular formula C22H20Cl4O4 and a molecular weight of 490.21 g/mol. Its IUPAC name is (E)-4-[4-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[4-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 87864023 |
| Molecular Formula | C22H20Cl4O4 |
| Molecular Weight | 490.21 g/mol |
| Exact Mass | 488.01 |
| IUPAC Name | (E)-4-[4-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1ccc(OCCCOc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C22H20Cl4O4/c1-15(27)3-4-16-5-7-17(8-6-16)28-10-2-11-30-22-19(23)13-18(14-20(22)24)29-12-9-21(25)26/h3-9,13-14H,2,10-12H2,1H3/b4-3+ |
| InChIKey | XBVUPPVYPHVZMR-ONEGZZNKSA-N |
| XLogP | 7.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.21 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|