C20H18Cl4O4 — CID 18429564
1-[4-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]ethanone (PubChem CID 18429564) has the molecular formula C20H18Cl4O4 and a molecular weight of 464.17 g/mol. Its IUPAC name is 1-[4-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]ethanone.
| Compound Name | 1-[4-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 18429564 |
| Molecular Formula | C20H18Cl4O4 |
| Molecular Weight | 464.17 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | 1-[4-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCCCOc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H18Cl4O4/c1-13(25)14-3-5-15(6-4-14)26-8-2-9-28-20-17(21)11-16(12-18(20)22)27-10-7-19(23)24/h3-7,11-12H,2,8-10H2,1H3 |
| InChIKey | LOJKZJILYXIWNF-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.17 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|