C19H15Cl4FO3 — CID 86613088
4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]-1-(4-fluorophenyl)butan-1-one (PubChem CID 86613088) has the molecular formula C19H15Cl4FO3 and a molecular weight of 452.14 g/mol. Its IUPAC name is 4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]-1-(4-fluorophenyl)butan-1-one.
| Compound Name | 4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]-1-(4-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 86613088 |
| Molecular Formula | C19H15Cl4FO3 |
| Molecular Weight | 452.14 g/mol |
| Exact Mass | 449.98 |
| IUPAC Name | 4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]-1-(4-fluorophenyl)butan-1-one |
| SMILES | O=C(CCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H15Cl4FO3/c20-15-10-14(26-9-7-18(22)23)11-16(21)19(15)27-8-1-2-17(25)12-3-5-13(24)6-4-12/h3-7,10-11H,1-2,8-9H2 |
| InChIKey | ROBPSQJRFKQVIE-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.14 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|