C16H18Cl4O4 — CID 54045208
2-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]acetaldehyde (PubChem CID 54045208) has the molecular formula C16H18Cl4O4 and a molecular weight of 416.13 g/mol. Its IUPAC name is 2-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]acetaldehyde.
| Compound Name | 2-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]acetaldehyde |
|---|---|
| PubChem CID | 54045208 |
| Molecular Formula | C16H18Cl4O4 |
| Molecular Weight | 416.13 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | 2-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]acetaldehyde |
| SMILES | O=CCOCCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C16H18Cl4O4/c17-13-10-12(23-8-4-15(19)20)11-14(18)16(13)24-7-3-1-2-6-22-9-5-21/h4-5,10-11H,1-3,6-9H2 |
| InChIKey | LPBORXRSYAVCJH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.13 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|