C22H23Cl4NO4 — CID 54013461
2-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-N-phenoxyethanimine (PubChem CID 54013461) has the molecular formula C22H23Cl4NO4 and a molecular weight of 507.24 g/mol. Its IUPAC name is 2-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-N-phenoxyethanimine.
| Compound Name | 2-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-N-phenoxyethanimine |
|---|---|
| PubChem CID | 54013461 |
| Molecular Formula | C22H23Cl4NO4 |
| Molecular Weight | 507.24 g/mol |
| Exact Mass | 505.04 |
| IUPAC Name | 2-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-N-phenoxyethanimine |
| SMILES | ClC(Cl)=CCOc1cc(Cl)c(OCCCCCOCC=NOc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C22H23Cl4NO4/c23-19-15-18(29-13-9-21(25)26)16-20(24)22(19)30-12-6-2-5-11-28-14-10-27-31-17-7-3-1-4-8-17/h1,3-4,7-10,15-16H,2,5-6,11-14H2 |
| InChIKey | KTZHAHXDRKXFFF-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.24 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|