C16H19Cl4NO4 — CID 18430241
(NE)-N-[3-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butoxy]propylidene]hydroxylamine (PubChem CID 18430241) has the molecular formula C16H19Cl4NO4 and a molecular weight of 431.14 g/mol. Its IUPAC name is (NE)-N-[3-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butoxy]propylidene]hydroxylamine.
| Compound Name | (NE)-N-[3-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butoxy]propylidene]hydroxylamine |
|---|---|
| PubChem CID | 18430241 |
| Molecular Formula | C16H19Cl4NO4 |
| Molecular Weight | 431.14 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | (NE)-N-[3-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butoxy]propylidene]hydroxylamine |
| SMILES | O/N=C/CCOCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C16H19Cl4NO4/c17-13-10-12(24-9-4-15(19)20)11-14(18)16(13)25-8-2-1-6-23-7-3-5-21-22/h4-5,10-11,22H,1-3,6-9H2/b21-5+ |
| InChIKey | QZWFCFNZSGUUKN-IGCPIRJNSA-N |
| XLogP | 5.72 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.14 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|