C17H17Cl6NO3 — CID 54031581
5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]-N-(3,3-dichloroprop-2-enoxy)pentan-1-imine (PubChem CID 54031581) has the molecular formula C17H17Cl6NO3 and a molecular weight of 496.05 g/mol. Its IUPAC name is 5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]-N-(3,3-dichloroprop-2-enoxy)pentan-1-imine.
| Compound Name | 5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]-N-(3,3-dichloroprop-2-enoxy)pentan-1-imine |
|---|---|
| PubChem CID | 54031581 |
| Molecular Formula | C17H17Cl6NO3 |
| Molecular Weight | 496.05 g/mol |
| Exact Mass | 492.93 |
| IUPAC Name | 5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]-N-(3,3-dichloroprop-2-enoxy)pentan-1-imine |
| SMILES | ClC(Cl)=CCON=CCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C17H17Cl6NO3/c18-13-10-12(25-8-4-15(20)21)11-14(19)17(13)26-7-3-1-2-6-24-27-9-5-16(22)23/h4-6,10-11H,1-3,7-9H2 |
| InChIKey | LFZBIDHXDYZNDF-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.05 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|