C16H18Cl5NO3 — CID 18429424
(E)-2-chloro-N-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]ethanimine (PubChem CID 18429424) has the molecular formula C16H18Cl5NO3 and a molecular weight of 449.59 g/mol. Its IUPAC name is (E)-2-chloro-N-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]ethanimine.
| Compound Name | (E)-2-chloro-N-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]ethanimine |
|---|---|
| PubChem CID | 18429424 |
| Molecular Formula | C16H18Cl5NO3 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 446.97 |
| IUPAC Name | (E)-2-chloro-N-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]ethanimine |
| SMILES | ClC/C=N/OCCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C16H18Cl5NO3/c17-5-6-22-25-8-3-1-2-7-24-16-13(18)10-12(11-14(16)19)23-9-4-15(20)21/h4,6,10-11H,1-3,5,7-9H2/b22-6+ |
| InChIKey | LCLWDHDMTWUABR-GEVRCRHISA-N |
| XLogP | 6.48 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|