C14H17Cl4NO2 — CID 22006786
5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentan-1-amine (PubChem CID 22006786) has the molecular formula C14H17Cl4NO2 and a molecular weight of 373.11 g/mol. Its IUPAC name is 5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentan-1-amine.
| Compound Name | 5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentan-1-amine |
|---|---|
| PubChem CID | 22006786 |
| Molecular Formula | C14H17Cl4NO2 |
| Molecular Weight | 373.11 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentan-1-amine |
| SMILES | NCCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl4NO2/c15-11-8-10(20-7-4-13(17)18)9-12(16)14(11)21-6-3-1-2-5-19/h4,8-9H,1-3,5-7,19H2 |
| InChIKey | IKSGBUOIMVCWKR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.11 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|