C21H25Cl6NO4 — CID 57267836
1-[6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexoxy]-N-(3,3-dichloroprop-2-enoxy)prop-1-en-2-amine (PubChem CID 57267836) has the molecular formula C21H25Cl6NO4 and a molecular weight of 568.15 g/mol. Its IUPAC name is 1-[6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexoxy]-N-(3,3-dichloroprop-2-enoxy)prop-1-en-2-amine.
| Compound Name | 1-[6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexoxy]-N-(3,3-dichloroprop-2-enoxy)prop-1-en-2-amine |
|---|---|
| PubChem CID | 57267836 |
| Molecular Formula | C21H25Cl6NO4 |
| Molecular Weight | 568.15 g/mol |
| Exact Mass | 564.99 |
| IUPAC Name | 1-[6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexoxy]-N-(3,3-dichloroprop-2-enoxy)prop-1-en-2-amine |
| SMILES | CC(=COCCCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl)NOCC=C(Cl)Cl |
| InChI | InChI=1S/C21H25Cl6NO4/c1-15(28-32-11-7-20(26)27)14-29-8-4-2-3-5-9-31-21-17(22)12-16(13-18(21)23)30-10-6-19(24)25/h6-7,12-14,28H,2-5,8-11H2,1H3 |
| InChIKey | UAHQWONRJIJRBJ-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.15 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|