C20H27Cl4NO4 — CID 57014913
2-butoxy-N-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]ethenamine (PubChem CID 57014913) has the molecular formula C20H27Cl4NO4 and a molecular weight of 487.25 g/mol. Its IUPAC name is 2-butoxy-N-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]ethenamine.
| Compound Name | 2-butoxy-N-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]ethenamine |
|---|---|
| PubChem CID | 57014913 |
| Molecular Formula | C20H27Cl4NO4 |
| Molecular Weight | 487.25 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 2-butoxy-N-[5-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]ethenamine |
| SMILES | CCCCOC=CNOCCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C20H27Cl4NO4/c1-2-3-9-26-13-8-25-29-11-6-4-5-10-28-20-17(21)14-16(15-18(20)22)27-12-7-19(23)24/h7-8,13-15,25H,2-6,9-12H2,1H3 |
| InChIKey | PWSFBURKFLZIDV-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.25 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|