C10H17Cl2NO2 — CID 57304019
N-(3,3-dichloroprop-2-enoxy)-2-pentoxyethenamine (PubChem CID 57304019) has the molecular formula C10H17Cl2NO2 and a molecular weight of 254.16 g/mol. Its IUPAC name is N-(3,3-dichloroprop-2-enoxy)-2-pentoxyethenamine.
| Compound Name | N-(3,3-dichloroprop-2-enoxy)-2-pentoxyethenamine |
|---|---|
| PubChem CID | 57304019 |
| Molecular Formula | C10H17Cl2NO2 |
| Molecular Weight | 254.16 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | N-(3,3-dichloroprop-2-enoxy)-2-pentoxyethenamine |
| SMILES | CCCCCOC=CNOCC=C(Cl)Cl |
| InChI | InChI=1S/C10H17Cl2NO2/c1-2-3-4-7-14-9-6-13-15-8-5-10(11)12/h5-6,9,13H,2-4,7-8H2,1H3 |
| InChIKey | XWZBWFRTFKEHLO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.16 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|