C18H23Cl4NO3 — CID 56998821
N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butoxy]-3-methylbut-2-en-2-amine (PubChem CID 56998821) has the molecular formula C18H23Cl4NO3 and a molecular weight of 443.20 g/mol. Its IUPAC name is N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butoxy]-3-methylbut-2-en-2-amine.
| Compound Name | N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butoxy]-3-methylbut-2-en-2-amine |
|---|---|
| PubChem CID | 56998821 |
| Molecular Formula | C18H23Cl4NO3 |
| Molecular Weight | 443.20 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butoxy]-3-methylbut-2-en-2-amine |
| SMILES | CC(C)=C(C)NOCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C18H23Cl4NO3/c1-12(2)13(3)23-26-8-5-4-7-25-18-15(19)10-14(11-16(18)20)24-9-6-17(21)22/h6,10-11,23H,4-5,7-9H2,1-3H3 |
| InChIKey | SQFASRNLOYUKCJ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.20 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|