About methyl N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butyl]carbamate
methyl N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butyl]carbamate (PubChem CID 19356488) has the molecular formula C15H17Cl4NO4
and a molecular weight of 417.12 g/mol. Its IUPAC name is methyl N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butyl]carbamate |
| PubChem CID | 19356488 |
| Molecular Formula | C15H17Cl4NO4 |
| Molecular Weight | 417.12 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | methyl N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butyl]carbamate |
| SMILES | COC(=O)NCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C15H17Cl4NO4/c1-22-15(21)20-5-2-3-6-24-14-11(16)8-10(9-12(14)17)23-7-4-13(18)19/h4,8-9H,2-3,5-7H2,1H3,(H,20,21) |
| InChIKey | WUBXTNSKLIIHQX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.12 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butyl]carbamate?
The IUPAC name of methyl N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butyl]carbamate (CID 19356488) is methyl N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butyl]carbamate.
What is the SMILES notation for methyl N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butyl]carbamate?
The canonical SMILES for methyl N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butyl]carbamate is COC(=O)NCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl.
What is the InChIKey of methyl N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butyl]carbamate?
The InChIKey is WUBXTNSKLIIHQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17Cl4NO4/c1-22-15(21)20-5-2-3-6-24-14-11(16)8-10(9-12(14)17)23-7-4-13(18)19/h4,8-9H,2-3,5-7H2,1H3,(H,20,21).
What are the key properties of methyl N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butyl]carbamate?
methyl N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butyl]carbamate has a molecular weight of 417.12 g/mol, XLogP of 5.21, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[4-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]butyl]carbamate is sourced from PubChem (CID 19356488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).