C14H12Cl4F3NO3 — CID 19356554
N-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propyl]-2,2,2-trifluoroacetamide (PubChem CID 19356554) has the molecular formula C14H12Cl4F3NO3 and a molecular weight of 441.06 g/mol. Its IUPAC name is N-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 19356554 |
| Molecular Formula | C14H12Cl4F3NO3 |
| Molecular Weight | 441.06 g/mol |
| Exact Mass | 438.95 |
| IUPAC Name | N-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C14H12Cl4F3NO3/c15-9-6-8(24-5-2-11(17)18)7-10(16)12(9)25-4-1-3-22-13(23)14(19,20)21/h2,6-7H,1,3-5H2,(H,22,23) |
| InChIKey | QVAJAFURIYCWTH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.06 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|