C19H15Cl6NO3 — CID 19356552
2,4-dichloro-N-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propyl]benzamide (PubChem CID 19356552) has the molecular formula C19H15Cl6NO3 and a molecular weight of 518.05 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propyl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propyl]benzamide |
|---|---|
| PubChem CID | 19356552 |
| Molecular Formula | C19H15Cl6NO3 |
| Molecular Weight | 518.05 g/mol |
| Exact Mass | 514.92 |
| IUPAC Name | 2,4-dichloro-N-[3-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]propyl]benzamide |
| SMILES | O=C(NCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H15Cl6NO3/c20-11-2-3-13(14(21)8-11)19(27)26-5-1-6-29-18-15(22)9-12(10-16(18)23)28-7-4-17(24)25/h2-4,8-10H,1,5-7H2,(H,26,27) |
| InChIKey | UCMUIZQFAKBCJS-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.05 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|