C23H25Cl3FNO3 — CID 19356505
4-chloro-N-[3-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]propyl]-2-fluorobenzamide (PubChem CID 19356505) has the molecular formula C23H25Cl3FNO3 and a molecular weight of 488.81 g/mol. Its IUPAC name is 4-chloro-N-[3-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]propyl]-2-fluorobenzamide.
| Compound Name | 4-chloro-N-[3-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]propyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 19356505 |
| Molecular Formula | C23H25Cl3FNO3 |
| Molecular Weight | 488.81 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 4-chloro-N-[3-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]propyl]-2-fluorobenzamide |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(CC)c1OCCCNC(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C23H25Cl3FNO3/c1-3-15-12-18(30-11-8-21(25)26)13-16(4-2)22(15)31-10-5-9-28-23(29)19-7-6-17(24)14-20(19)27/h6-8,12-14H,3-5,9-11H2,1-2H3,(H,28,29) |
| InChIKey | XXLCTKZJANMZKM-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.81 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|