About 2-(3-bromopropoxy)-5-(3,3-dichloroprop-2-enoxy)-1,3-diethylbenzene
2-(3-bromopropoxy)-5-(3,3-dichloroprop-2-enoxy)-1,3-diethylbenzene (PubChem CID 54380239) has the molecular formula C16H21BrCl2O2
and a molecular weight of 396.15 g/mol. Its IUPAC name is 2-(3-bromopropoxy)-5-(3,3-dichloroprop-2-enoxy)-1,3-diethylbenzene.
Molecular Properties
| Compound Name | 2-(3-bromopropoxy)-5-(3,3-dichloroprop-2-enoxy)-1,3-diethylbenzene |
| PubChem CID | 54380239 |
| Molecular Formula | C16H21BrCl2O2 |
| Molecular Weight | 396.15 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 2-(3-bromopropoxy)-5-(3,3-dichloroprop-2-enoxy)-1,3-diethylbenzene |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(CC)c1OCCCBr |
| InChI | InChI=1S/C16H21BrCl2O2/c1-3-12-10-14(20-9-6-15(18)19)11-13(4-2)16(12)21-8-5-7-17/h6,10-11H,3-5,7-9H2,1-2H3 |
| InChIKey | UZJNBFBUWYGKIE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.15 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromopropoxy)-5-(3,3-dichloroprop-2-enoxy)-1,3-diethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromopropoxy)-5-(3,3-dichloroprop-2-enoxy)-1,3-diethylbenzene?
The IUPAC name of 2-(3-bromopropoxy)-5-(3,3-dichloroprop-2-enoxy)-1,3-diethylbenzene (CID 54380239) is 2-(3-bromopropoxy)-5-(3,3-dichloroprop-2-enoxy)-1,3-diethylbenzene.
What is the SMILES notation for 2-(3-bromopropoxy)-5-(3,3-dichloroprop-2-enoxy)-1,3-diethylbenzene?
The canonical SMILES for 2-(3-bromopropoxy)-5-(3,3-dichloroprop-2-enoxy)-1,3-diethylbenzene is CCc1cc(OCC=C(Cl)Cl)cc(CC)c1OCCCBr.
What is the InChIKey of 2-(3-bromopropoxy)-5-(3,3-dichloroprop-2-enoxy)-1,3-diethylbenzene?
The InChIKey is UZJNBFBUWYGKIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21BrCl2O2/c1-3-12-10-14(20-9-6-15(18)19)11-13(4-2)16(12)21-8-5-7-17/h6,10-11H,3-5,7-9H2,1-2H3.
What are the key properties of 2-(3-bromopropoxy)-5-(3,3-dichloroprop-2-enoxy)-1,3-diethylbenzene?
2-(3-bromopropoxy)-5-(3,3-dichloroprop-2-enoxy)-1,3-diethylbenzene has a molecular weight of 396.15 g/mol, XLogP of 5.67, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromopropoxy)-5-(3,3-dichloroprop-2-enoxy)-1,3-diethylbenzene is sourced from PubChem (CID 54380239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).