C16H21BrCl2O2 — CID 54380239
2-(3-bromopropoxy)-5-(3,3-dichloroprop-2-enoxy)-1,3-diethylbenzene (PubChem CID 54380239) has the molecular formula C16H21BrCl2O2 and a molecular weight of 396.15 g/mol. Its IUPAC name is 2-(3-bromopropoxy)-5-(3,3-dichloroprop-2-enoxy)-1,3-diethylbenzene.
| Compound Name | 2-(3-bromopropoxy)-5-(3,3-dichloroprop-2-enoxy)-1,3-diethylbenzene |
|---|---|
| PubChem CID | 54380239 |
| Molecular Formula | C16H21BrCl2O2 |
| Molecular Weight | 396.15 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 2-(3-bromopropoxy)-5-(3,3-dichloroprop-2-enoxy)-1,3-diethylbenzene |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(CC)c1OCCCBr |
| InChI | InChI=1S/C16H21BrCl2O2/c1-3-12-10-14(20-9-6-15(18)19)11-13(4-2)16(12)21-8-5-7-17/h6,10-11H,3-5,7-9H2,1-2H3 |
| InChIKey | UZJNBFBUWYGKIE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.15 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|