About (NE)-N-[5-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentylidene]hydroxylamine
(NE)-N-[5-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentylidene]hydroxylamine (PubChem CID 18429714) has the molecular formula C17H23Cl2NO3
and a molecular weight of 360.28 g/mol. Its IUPAC name is (NE)-N-[5-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[5-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentylidene]hydroxylamine |
| PubChem CID | 18429714 |
| Molecular Formula | C17H23Cl2NO3 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | (NE)-N-[5-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentylidene]hydroxylamine |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(C)c1OCCCC/C=N/O |
| InChI | InChI=1S/C17H23Cl2NO3/c1-3-14-12-15(22-10-7-16(18)19)11-13(2)17(14)23-9-6-4-5-8-20-21/h7-8,11-12,21H,3-6,9-10H2,1-2H3/b20-8+ |
| InChIKey | RFAIXYHNHFIDTM-DNTJNYDQSA-N |
| XLogP | 5.26 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[5-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[5-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentylidene]hydroxylamine?
The IUPAC name of (NE)-N-[5-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentylidene]hydroxylamine (CID 18429714) is (NE)-N-[5-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentylidene]hydroxylamine.
What is the SMILES notation for (NE)-N-[5-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentylidene]hydroxylamine?
The canonical SMILES for (NE)-N-[5-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentylidene]hydroxylamine is CCc1cc(OCC=C(Cl)Cl)cc(C)c1OCCCC/C=N/O.
What is the InChIKey of (NE)-N-[5-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentylidene]hydroxylamine?
The InChIKey is RFAIXYHNHFIDTM-DNTJNYDQSA-N. The full InChI is InChI=1S/C17H23Cl2NO3/c1-3-14-12-15(22-10-7-16(18)19)11-13(2)17(14)23-9-6-4-5-8-20-21/h7-8,11-12,21H,3-6,9-10H2,1-2H3/b20-8+.
What are the key properties of (NE)-N-[5-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentylidene]hydroxylamine?
(NE)-N-[5-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentylidene]hydroxylamine has a molecular weight of 360.28 g/mol, XLogP of 5.26, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[5-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentylidene]hydroxylamine is sourced from PubChem (CID 18429714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).