C23H35Cl2NO4 — CID 173216439
5-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentyl N-[(2-methylpropan-2-yl)oxy]ethanimidate (PubChem CID 173216439) has the molecular formula C23H35Cl2NO4 and a molecular weight of 460.44 g/mol. Its IUPAC name is 5-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentyl N-[(2-methylpropan-2-yl)oxy]ethanimidate.
| Compound Name | 5-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentyl N-[(2-methylpropan-2-yl)oxy]ethanimidate |
|---|---|
| PubChem CID | 173216439 |
| Molecular Formula | C23H35Cl2NO4 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 5-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentyl N-[(2-methylpropan-2-yl)oxy]ethanimidate |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(C)c1OCCCCCOC(C)=NOC(C)(C)C |
| InChI | InChI=1S/C23H35Cl2NO4/c1-7-19-16-20(28-14-11-21(24)25)15-17(2)22(19)29-13-10-8-9-12-27-18(3)26-30-23(4,5)6/h11,15-16H,7-10,12-14H2,1-6H3 |
| InChIKey | YMGRDZGBBIAUNH-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|