C20H25Cl4NO4 — CID 57255270
N-(3,3-dichloroprop-2-enoxy)-1-[2-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]ethoxy]prop-1-en-2-amine (PubChem CID 57255270) has the molecular formula C20H25Cl4NO4 and a molecular weight of 485.24 g/mol. Its IUPAC name is N-(3,3-dichloroprop-2-enoxy)-1-[2-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]ethoxy]prop-1-en-2-amine.
| Compound Name | N-(3,3-dichloroprop-2-enoxy)-1-[2-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]ethoxy]prop-1-en-2-amine |
|---|---|
| PubChem CID | 57255270 |
| Molecular Formula | C20H25Cl4NO4 |
| Molecular Weight | 485.24 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | N-(3,3-dichloroprop-2-enoxy)-1-[2-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]ethoxy]prop-1-en-2-amine |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(C)c1OCCOC=C(C)NOCC=C(Cl)Cl |
| InChI | InChI=1S/C20H25Cl4NO4/c1-4-16-12-17(27-7-5-18(21)22)11-14(2)20(16)28-10-9-26-13-15(3)25-29-8-6-19(23)24/h5-6,11-13,25H,4,7-10H2,1-3H3 |
| InChIKey | MQXKZKCLSZDUFS-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.24 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|