C24H30Cl2O4 — CID 54334613
5-(3,3-dichloroprop-2-enoxy)-1-ethyl-3-methyl-2-[3-(4-propan-2-yloxyphenoxy)propoxy]benzene (PubChem CID 54334613) has the molecular formula C24H30Cl2O4 and a molecular weight of 453.41 g/mol. Its IUPAC name is 5-(3,3-dichloroprop-2-enoxy)-1-ethyl-3-methyl-2-[3-(4-propan-2-yloxyphenoxy)propoxy]benzene.
| Compound Name | 5-(3,3-dichloroprop-2-enoxy)-1-ethyl-3-methyl-2-[3-(4-propan-2-yloxyphenoxy)propoxy]benzene |
|---|---|
| PubChem CID | 54334613 |
| Molecular Formula | C24H30Cl2O4 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 5-(3,3-dichloroprop-2-enoxy)-1-ethyl-3-methyl-2-[3-(4-propan-2-yloxyphenoxy)propoxy]benzene |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(C)c1OCCCOc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C24H30Cl2O4/c1-5-19-16-22(28-14-11-23(25)26)15-18(4)24(19)29-13-6-12-27-20-7-9-21(10-8-20)30-17(2)3/h7-11,15-17H,5-6,12-14H2,1-4H3 |
| InChIKey | TUOJMAZUTYESLN-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|