C26H34BrFO4 — CID 139747898
5-(3-bromo-3-fluoroprop-2-enoxy)-1,3-diethyl-2-[4-(4-propan-2-yloxyphenoxy)butoxy]benzene (PubChem CID 139747898) has the molecular formula C26H34BrFO4 and a molecular weight of 509.46 g/mol. Its IUPAC name is 5-(3-bromo-3-fluoroprop-2-enoxy)-1,3-diethyl-2-[4-(4-propan-2-yloxyphenoxy)butoxy]benzene.
| Compound Name | 5-(3-bromo-3-fluoroprop-2-enoxy)-1,3-diethyl-2-[4-(4-propan-2-yloxyphenoxy)butoxy]benzene |
|---|---|
| PubChem CID | 139747898 |
| Molecular Formula | C26H34BrFO4 |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | 5-(3-bromo-3-fluoroprop-2-enoxy)-1,3-diethyl-2-[4-(4-propan-2-yloxyphenoxy)butoxy]benzene |
| SMILES | CCc1cc(OCC=C(F)Br)cc(CC)c1OCCCCOc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C26H34BrFO4/c1-5-20-17-24(30-16-13-25(27)28)18-21(6-2)26(20)31-15-8-7-14-29-22-9-11-23(12-10-22)32-19(3)4/h9-13,17-19H,5-8,14-16H2,1-4H3 |
| InChIKey | BWPTVJLSGJOQLR-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|