C21H32Cl2O5 — CID 23282353
5-(3,3-dichloroprop-2-enoxy)-2-[4-(2,2-dimethoxyethoxy)butoxy]-1,3-diethylbenzene (PubChem CID 23282353) has the molecular formula C21H32Cl2O5 and a molecular weight of 435.39 g/mol. Its IUPAC name is 5-(3,3-dichloroprop-2-enoxy)-2-[4-(2,2-dimethoxyethoxy)butoxy]-1,3-diethylbenzene.
| Compound Name | 5-(3,3-dichloroprop-2-enoxy)-2-[4-(2,2-dimethoxyethoxy)butoxy]-1,3-diethylbenzene |
|---|---|
| PubChem CID | 23282353 |
| Molecular Formula | C21H32Cl2O5 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 5-(3,3-dichloroprop-2-enoxy)-2-[4-(2,2-dimethoxyethoxy)butoxy]-1,3-diethylbenzene |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(CC)c1OCCCCOCC(OC)OC |
| InChI | InChI=1S/C21H32Cl2O5/c1-5-16-13-18(27-12-9-19(22)23)14-17(6-2)21(16)28-11-8-7-10-26-15-20(24-3)25-4/h9,13-14,20H,5-8,10-12,15H2,1-4H3 |
| InChIKey | AITNDCLUNMIHNH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|