C26H33Cl2NO4 — CID 18429885
(E)-2-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butoxy]-N-phenylmethoxyethanimine (PubChem CID 18429885) has the molecular formula C26H33Cl2NO4 and a molecular weight of 494.46 g/mol. Its IUPAC name is (E)-2-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butoxy]-N-phenylmethoxyethanimine.
| Compound Name | (E)-2-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butoxy]-N-phenylmethoxyethanimine |
|---|---|
| PubChem CID | 18429885 |
| Molecular Formula | C26H33Cl2NO4 |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | (E)-2-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butoxy]-N-phenylmethoxyethanimine |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(CC)c1OCCCCOC/C=N/OCc1ccccc1 |
| InChI | InChI=1S/C26H33Cl2NO4/c1-3-22-18-24(31-16-12-25(27)28)19-23(4-2)26(22)32-15-9-8-14-30-17-13-29-33-20-21-10-6-5-7-11-21/h5-7,10-13,18-19H,3-4,8-9,14-17,20H2,1-2H3/b29-13+ |
| InChIKey | VHLKKKJFJZHPEB-VFLNYLIXSA-N |
| XLogP | 6.89 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|