C26H30Cl2F3NO3 — CID 54026118
N-[5-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]pentoxy]-1-[4-(trifluoromethyl)phenyl]methanimine (PubChem CID 54026118) has the molecular formula C26H30Cl2F3NO3 and a molecular weight of 532.43 g/mol. Its IUPAC name is N-[5-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]pentoxy]-1-[4-(trifluoromethyl)phenyl]methanimine.
| Compound Name | N-[5-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]pentoxy]-1-[4-(trifluoromethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 54026118 |
| Molecular Formula | C26H30Cl2F3NO3 |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | N-[5-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]pentoxy]-1-[4-(trifluoromethyl)phenyl]methanimine |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(CC)c1OCCCCCON=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H30Cl2F3NO3/c1-3-20-16-23(33-15-12-24(27)28)17-21(4-2)25(20)34-13-6-5-7-14-35-32-18-19-8-10-22(11-9-19)26(29,30)31/h8-12,16-18H,3-7,13-15H2,1-2H3 |
| InChIKey | LCHFEUYSADBNCM-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|