C24H26Cl2F3NO3 — CID 54482523
N-[4-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]butoxy]-1-[4-(trifluoromethyl)phenyl]methanimine (PubChem CID 54482523) has the molecular formula C24H26Cl2F3NO3 and a molecular weight of 504.38 g/mol. Its IUPAC name is N-[4-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]butoxy]-1-[4-(trifluoromethyl)phenyl]methanimine.
| Compound Name | N-[4-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]butoxy]-1-[4-(trifluoromethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 54482523 |
| Molecular Formula | C24H26Cl2F3NO3 |
| Molecular Weight | 504.38 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | N-[4-[4-(3,3-dichloroprop-2-enoxy)-2-ethyl-6-methylphenoxy]butoxy]-1-[4-(trifluoromethyl)phenyl]methanimine |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(C)c1OCCCCON=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H26Cl2F3NO3/c1-3-19-15-21(31-13-10-22(25)26)14-17(2)23(19)32-11-4-5-12-33-30-16-18-6-8-20(9-7-18)24(27,28)29/h6-10,14-16H,3-5,11-13H2,1-2H3 |
| InChIKey | XQAKTPLGEWZOIY-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.38 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|