C23H27Cl2F3N2O2 — CID 18504691
N-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 18504691) has the molecular formula C23H27Cl2F3N2O2 and a molecular weight of 491.38 g/mol. Its IUPAC name is N-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butyl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butyl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 18504691 |
| Molecular Formula | C23H27Cl2F3N2O2 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | N-[4-[4-(3,3-dichloroprop-2-enoxy)-2,6-diethylphenoxy]butyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCc1cc(OCC=C(Cl)Cl)cc(CC)c1OCCCCNc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C23H27Cl2F3N2O2/c1-3-16-13-19(31-12-9-20(24)25)14-17(4-2)22(16)32-11-6-5-10-29-21-8-7-18(15-30-21)23(26,27)28/h7-9,13-15H,3-6,10-12H2,1-2H3,(H,29,30) |
| InChIKey | YWGSCUXEDWVTMH-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|