C21H19Cl3F3NO4 — CID 22318626
1-[3-chloro-5-(3,3-dichloroprop-2-enoxy)-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]butoxy]phenyl]ethanone (PubChem CID 22318626) has the molecular formula C21H19Cl3F3NO4 and a molecular weight of 512.74 g/mol. Its IUPAC name is 1-[3-chloro-5-(3,3-dichloroprop-2-enoxy)-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]butoxy]phenyl]ethanone.
| Compound Name | 1-[3-chloro-5-(3,3-dichloroprop-2-enoxy)-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]butoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 22318626 |
| Molecular Formula | C21H19Cl3F3NO4 |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 511.03 |
| IUPAC Name | 1-[3-chloro-5-(3,3-dichloroprop-2-enoxy)-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]butoxy]phenyl]ethanone |
| SMILES | CC(=O)c1cc(OCC=C(Cl)Cl)cc(Cl)c1OCCCCOc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C21H19Cl3F3NO4/c1-13(29)16-10-15(30-9-6-18(23)24)11-17(22)20(16)32-8-3-2-7-31-19-5-4-14(12-28-19)21(25,26)27/h4-6,10-12H,2-3,7-9H2,1H3 |
| InChIKey | FWWCNHFEXXYPGV-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|